About octan-2-yl 2-amino-4-nitrobenzoate
octan-2-yl 2-amino-4-nitrobenzoate (PubChem CID 63540460) has the molecular formula C15H22N2O4
and a molecular weight of 294.35 g/mol. Its IUPAC name is octan-2-yl 2-amino-4-nitrobenzoate.
Molecular Properties
| Compound Name | octan-2-yl 2-amino-4-nitrobenzoate |
| PubChem CID | 63540460 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | octan-2-yl 2-amino-4-nitrobenzoate |
| SMILES | CCCCCCC(C)OC(=O)c1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C15H22N2O4/c1-3-4-5-6-7-11(2)21-15(18)13-9-8-12(17(19)20)10-14(13)16/h8-11H,3-7,16H2,1-2H3 |
| InChIKey | OSCJBQCSTIMPAD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze octan-2-yl 2-amino-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-yl 2-amino-4-nitrobenzoate?
The IUPAC name of octan-2-yl 2-amino-4-nitrobenzoate (CID 63540460) is octan-2-yl 2-amino-4-nitrobenzoate.
What is the SMILES notation for octan-2-yl 2-amino-4-nitrobenzoate?
The canonical SMILES for octan-2-yl 2-amino-4-nitrobenzoate is CCCCCCC(C)OC(=O)c1ccc([N+](=O)[O-])cc1N.
What is the InChIKey of octan-2-yl 2-amino-4-nitrobenzoate?
The InChIKey is OSCJBQCSTIMPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O4/c1-3-4-5-6-7-11(2)21-15(18)13-9-8-12(17(19)20)10-14(13)16/h8-11H,3-7,16H2,1-2H3.
What are the key properties of octan-2-yl 2-amino-4-nitrobenzoate?
octan-2-yl 2-amino-4-nitrobenzoate has a molecular weight of 294.35 g/mol, XLogP of 3.69, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-yl 2-amino-4-nitrobenzoate is sourced from PubChem (CID 63540460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).