About pentan-3-yl 2-amino-5-nitrobenzoate
pentan-3-yl 2-amino-5-nitrobenzoate (PubChem CID 91727772) has the molecular formula C12H16N2O4
and a molecular weight of 252.27 g/mol. Its IUPAC name is pentan-3-yl 2-amino-5-nitrobenzoate.
Molecular Properties
| Compound Name | pentan-3-yl 2-amino-5-nitrobenzoate |
| PubChem CID | 91727772 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | pentan-3-yl 2-amino-5-nitrobenzoate |
| SMILES | CCC(CC)OC(=O)c1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C12H16N2O4/c1-3-9(4-2)18-12(15)10-7-8(14(16)17)5-6-11(10)13/h5-7,9H,3-4,13H2,1-2H3 |
| InChIKey | YJTLBAULJVPJPF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-yl 2-amino-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yl 2-amino-5-nitrobenzoate?
The IUPAC name of pentan-3-yl 2-amino-5-nitrobenzoate (CID 91727772) is pentan-3-yl 2-amino-5-nitrobenzoate.
What is the SMILES notation for pentan-3-yl 2-amino-5-nitrobenzoate?
The canonical SMILES for pentan-3-yl 2-amino-5-nitrobenzoate is CCC(CC)OC(=O)c1cc([N+](=O)[O-])ccc1N.
What is the InChIKey of pentan-3-yl 2-amino-5-nitrobenzoate?
The InChIKey is YJTLBAULJVPJPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c1-3-9(4-2)18-12(15)10-7-8(14(16)17)5-6-11(10)13/h5-7,9H,3-4,13H2,1-2H3.
What are the key properties of pentan-3-yl 2-amino-5-nitrobenzoate?
pentan-3-yl 2-amino-5-nitrobenzoate has a molecular weight of 252.27 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yl 2-amino-5-nitrobenzoate is sourced from PubChem (CID 91727772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).