About [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate
[(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate (PubChem CID 32739392) has the molecular formula C10H9N3O4
and a molecular weight of 235.20 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate.
Molecular Properties
| Compound Name | [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate |
| PubChem CID | 32739392 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate |
| SMILES | C[C@H](C#N)OC(=O)c1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C10H9N3O4/c1-6(5-11)17-10(14)8-3-2-7(13(15)16)4-9(8)12/h2-4,6H,12H2,1H3/t6-/m1/s1 |
| InChIKey | XEFSDEJBSADEMM-ZCFIWIBFSA-N |
| XLogP | 1.25 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate?
The IUPAC name of [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate (CID 32739392) is [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate.
What is the SMILES notation for [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate?
The canonical SMILES for [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate is C[C@H](C#N)OC(=O)c1ccc([N+](=O)[O-])cc1N.
What is the InChIKey of [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate?
The InChIKey is XEFSDEJBSADEMM-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H9N3O4/c1-6(5-11)17-10(14)8-3-2-7(13(15)16)4-9(8)12/h2-4,6H,12H2,1H3/t6-/m1/s1.
What are the key properties of [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate?
[(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate has a molecular weight of 235.20 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-cyanoethyl] 2-amino-4-nitrobenzoate is sourced from PubChem (CID 32739392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).