C16H20N4O5 — CID 18100389
[1-[(2-cyano-3-methylbutan-2-yl)amino]-1-oxopropan-2-yl] 2-amino-4-nitrobenzoate (PubChem CID 18100389) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is [1-[(2-cyano-3-methylbutan-2-yl)amino]-1-oxopropan-2-yl] 2-amino-4-nitrobenzoate.
| Compound Name | [1-[(2-cyano-3-methylbutan-2-yl)amino]-1-oxopropan-2-yl] 2-amino-4-nitrobenzoate |
|---|---|
| PubChem CID | 18100389 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [1-[(2-cyano-3-methylbutan-2-yl)amino]-1-oxopropan-2-yl] 2-amino-4-nitrobenzoate |
| SMILES | CC(OC(=O)c1ccc([N+](=O)[O-])cc1N)C(=O)NC(C)(C#N)C(C)C |
| InChI | InChI=1S/C16H20N4O5/c1-9(2)16(4,8-17)19-14(21)10(3)25-15(22)12-6-5-11(20(23)24)7-13(12)18/h5-7,9-10H,18H2,1-4H3,(H,19,21) |
| InChIKey | ZZWVKPMATMUJAR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|