About [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate
[(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate (PubChem CID 7825497) has the molecular formula C17H15N3O4
and a molecular weight of 325.32 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate.
Molecular Properties
| Compound Name | [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate |
| PubChem CID | 7825497 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate |
| SMILES | C[C@H](C#N)OC(=O)c1cc([N+](=O)[O-])ccc1NCc1ccccc1 |
| InChI | InChI=1S/C17H15N3O4/c1-12(10-18)24-17(21)15-9-14(20(22)23)7-8-16(15)19-11-13-5-3-2-4-6-13/h2-9,12,19H,11H2,1H3/t12-/m1/s1 |
| InChIKey | FSHIWSCZASHRMZ-GFCCVEGCSA-N |
| XLogP | 3.28 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate?
The IUPAC name of [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate (CID 7825497) is [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate.
What is the SMILES notation for [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate?
The canonical SMILES for [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate is C[C@H](C#N)OC(=O)c1cc([N+](=O)[O-])ccc1NCc1ccccc1.
What is the InChIKey of [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate?
The InChIKey is FSHIWSCZASHRMZ-GFCCVEGCSA-N. The full InChI is InChI=1S/C17H15N3O4/c1-12(10-18)24-17(21)15-9-14(20(22)23)7-8-16(15)19-11-13-5-3-2-4-6-13/h2-9,12,19H,11H2,1H3/t12-/m1/s1.
What are the key properties of [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate?
[(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate has a molecular weight of 325.32 g/mol, XLogP of 3.28, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-cyanoethyl] 2-(benzylamino)-5-nitrobenzoate is sourced from PubChem (CID 7825497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).