C24H20N4O5 — CID 24518636
1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-(benzylamino)-5-nitrobenzoate (PubChem CID 24518636) has the molecular formula C24H20N4O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-(benzylamino)-5-nitrobenzoate.
| Compound Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-(benzylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 24518636 |
| Molecular Formula | C24H20N4O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl 2-(benzylamino)-5-nitrobenzoate |
| SMILES | CC(OC(=O)c1cc([N+](=O)[O-])ccc1NCc1ccccc1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C24H20N4O5/c1-16(22-26-27-23(33-22)18-10-6-3-7-11-18)32-24(29)20-14-19(28(30)31)12-13-21(20)25-15-17-8-4-2-5-9-17/h2-14,16,25H,15H2,1H3 |
| InChIKey | INSMATYUPPTTIT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|