C22H17N3O7 — CID 46825417
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 5-(phenoxymethyl)furan-2-carboxylate (PubChem CID 46825417) has the molecular formula C22H17N3O7 and a molecular weight of 435.39 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 5-(phenoxymethyl)furan-2-carboxylate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 5-(phenoxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 46825417 |
| Molecular Formula | C22H17N3O7 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 5-(phenoxymethyl)furan-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(COc2ccccc2)o1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C22H17N3O7/c1-14(20-23-24-21(32-20)15-7-9-16(10-8-15)25(27)28)30-22(26)19-12-11-18(31-19)13-29-17-5-3-2-4-6-17/h2-12,14H,13H2,1H3 |
| InChIKey | UBSDSDQLWRDDJH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 130.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|