C18H12N4O5 — CID 7699190
[(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 4-cyanobenzoate (PubChem CID 7699190) has the molecular formula C18H12N4O5 and a molecular weight of 364.32 g/mol. Its IUPAC name is [(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 4-cyanobenzoate.
| Compound Name | [(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 7699190 |
| Molecular Formula | C18H12N4O5 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [(1S)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 4-cyanobenzoate |
| SMILES | C[C@H](OC(=O)c1ccc(C#N)cc1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C18H12N4O5/c1-11(26-18(23)14-4-2-12(10-19)3-5-14)16-20-21-17(27-16)13-6-8-15(9-7-13)22(24)25/h2-9,11H,1H3/t11-/m0/s1 |
| InChIKey | LKSWDPFLXJFCHQ-NSHDSACASA-N |
| XLogP | 3.43 |
| TPSA | 132.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|