C16H13N3O5S — CID 9415011
[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-methylthiophene-2-carboxylate (PubChem CID 9415011) has the molecular formula C16H13N3O5S and a molecular weight of 359.36 g/mol. Its IUPAC name is [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 9415011 |
| Molecular Formula | C16H13N3O5S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)O[C@H](C)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C16H13N3O5S/c1-9-7-8-25-13(9)16(20)23-10(2)14-17-18-15(24-14)11-3-5-12(6-4-11)19(21)22/h3-8,10H,1-2H3/t10-/m1/s1 |
| InChIKey | ATAHIDIFLGPYGB-SNVBAGLBSA-N |
| XLogP | 3.93 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|