C16H14N4O5S — CID 45281758
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 45281758) has the molecular formula C16H14N4O5S and a molecular weight of 374.38 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 2,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 45281758 |
| Molecular Formula | C16H14N4O5S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(C)c(C(=O)OC(C)c2nnc(-c3ccc([N+](=O)[O-])cc3)o2)s1 |
| InChI | InChI=1S/C16H14N4O5S/c1-8-13(26-10(3)17-8)16(21)24-9(2)14-18-19-15(25-14)11-4-6-12(7-5-11)20(22)23/h4-7,9H,1-3H3 |
| InChIKey | DSTHFIXOJCXWLT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 121.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|