C22H18N4O6 — CID 46676385
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 6-methoxy-2-methylquinoline-3-carboxylate (PubChem CID 46676385) has the molecular formula C22H18N4O6 and a molecular weight of 434.41 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 6-methoxy-2-methylquinoline-3-carboxylate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 6-methoxy-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 46676385 |
| Molecular Formula | C22H18N4O6 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 6-methoxy-2-methylquinoline-3-carboxylate |
| SMILES | COc1ccc2nc(C)c(C(=O)OC(C)c3nnc(-c4ccc([N+](=O)[O-])cc4)o3)cc2c1 |
| InChI | InChI=1S/C22H18N4O6/c1-12-18(11-15-10-17(30-3)8-9-19(15)23-12)22(27)31-13(2)20-24-25-21(32-20)14-4-6-16(7-5-14)26(28)29/h4-11,13H,1-3H3 |
| InChIKey | SINRDLOBDZKYCM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 130.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|