C17H13ClN4O5 — CID 40763008
[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-amino-4-chlorobenzoate (PubChem CID 40763008) has the molecular formula C17H13ClN4O5 and a molecular weight of 388.77 g/mol. Its IUPAC name is [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 40763008 |
| Molecular Formula | C17H13ClN4O5 |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 3-amino-4-chlorobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(Cl)c(N)c1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C17H13ClN4O5/c1-9(26-17(23)11-4-7-13(18)14(19)8-11)15-20-21-16(27-15)10-2-5-12(6-3-10)22(24)25/h2-9H,19H2,1H3/t9-/m1/s1 |
| InChIKey | FRBKTDWIZMTPEH-SECBINFHSA-N |
| XLogP | 3.80 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|