C17H10ClF2N3O5 — CID 7699899
[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 7699899) has the molecular formula C17H10ClF2N3O5 and a molecular weight of 409.73 g/mol. Its IUPAC name is [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 7699899 |
| Molecular Formula | C17H10ClF2N3O5 |
| Molecular Weight | 409.73 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(F)c(F)cc1Cl)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C17H10ClF2N3O5/c1-8(27-17(24)11-6-13(19)14(20)7-12(11)18)15-21-22-16(28-15)9-2-4-10(5-3-9)23(25)26/h2-8H,1H3/t8-/m1/s1 |
| InChIKey | MPCJUUUIDAGLJD-MRVPVSSYSA-N |
| XLogP | 4.49 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.73 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|