C15H12ClN3O3S — CID 18198799
1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 3-amino-4-chlorobenzoate (PubChem CID 18198799) has the molecular formula C15H12ClN3O3S and a molecular weight of 349.80 g/mol. Its IUPAC name is 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 3-amino-4-chlorobenzoate.
| Compound Name | 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 18198799 |
| Molecular Formula | C15H12ClN3O3S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 3-amino-4-chlorobenzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)c(N)c1)c1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C15H12ClN3O3S/c1-8(13-18-19-14(22-13)12-3-2-6-23-12)21-15(20)9-4-5-10(16)11(17)7-9/h2-8H,17H2,1H3 |
| InChIKey | YKVWXVWRJADVTK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|