C16H12N2O4S — CID 7698144
[(1R)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 4-formylbenzoate (PubChem CID 7698144) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is [(1R)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 4-formylbenzoate.
| Compound Name | [(1R)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 7698144 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | [(1R)-1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl] 4-formylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C=O)cc1)c1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C16H12N2O4S/c1-10(14-17-18-15(22-14)13-3-2-8-23-13)21-16(20)12-6-4-11(9-19)5-7-12/h2-10H,1H3/t10-/m1/s1 |
| InChIKey | WRNJBKVDUVFERY-SNVBAGLBSA-N |
| XLogP | 3.53 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|