C16H15N3O3S — CID 55391840
1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 2-amino-3-methylbenzoate (PubChem CID 55391840) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 2-amino-3-methylbenzoate.
| Compound Name | 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 2-amino-3-methylbenzoate |
|---|---|
| PubChem CID | 55391840 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 2-amino-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OC(C)c2nnc(-c3cccs3)o2)c1N |
| InChI | InChI=1S/C16H15N3O3S/c1-9-5-3-6-11(13(9)17)16(20)21-10(2)14-18-19-15(22-14)12-7-4-8-23-12/h3-8,10H,17H2,1-2H3 |
| InChIKey | LSXWFDNLURXSHT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|