C19H15N3O7 — CID 7604536
1-O-methyl 3-O-[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 7604536) has the molecular formula C19H15N3O7 and a molecular weight of 397.34 g/mol. Its IUPAC name is 1-O-methyl 3-O-[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7604536 |
| Molecular Formula | C19H15N3O7 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 1-O-methyl 3-O-[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)O[C@@H](C)c2nnc(-c3ccccc3)o2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15N3O7/c1-11(16-20-21-17(29-16)12-6-4-3-5-7-12)28-19(24)14-8-13(18(23)27-2)9-15(10-14)22(25)26/h3-11H,1-2H3/t11-/m0/s1 |
| InChIKey | SYXBLYBNSAQEEA-NSHDSACASA-N |
| XLogP | 3.35 |
| TPSA | 134.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|