C19H18N2O5 — CID 8872478
[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 3,5-dimethoxybenzoate (PubChem CID 8872478) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is [(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 3,5-dimethoxybenzoate.
| Compound Name | [(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 8872478 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)O[C@@H](C)c2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C19H18N2O5/c1-12(17-20-21-18(26-17)13-7-5-4-6-8-13)25-19(22)14-9-15(23-2)11-16(10-14)24-3/h4-12H,1-3H3/t12-/m0/s1 |
| InChIKey | MCZUJAVSDFHEEJ-LBPRGKRZSA-N |
| XLogP | 3.67 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |