C16H11Cl2N3O3 — CID 8873119
[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 8873119) has the molecular formula C16H11Cl2N3O3 and a molecular weight of 364.19 g/mol. Its IUPAC name is [(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8873119 |
| Molecular Formula | C16H11Cl2N3O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | [(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | C[C@H](OC(=O)c1cnc(Cl)c(Cl)c1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H11Cl2N3O3/c1-9(23-16(22)11-7-12(17)13(18)19-8-11)14-20-21-15(24-14)10-5-3-2-4-6-10/h2-9H,1H3/t9-/m0/s1 |
| InChIKey | TZSFADYSQMWZLK-VIFPVBQESA-N |
| XLogP | 4.36 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|