C17H13ClN2O3 — CID 7603572
[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 2-chlorobenzoate (PubChem CID 7603572) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.75 g/mol. Its IUPAC name is [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 2-chlorobenzoate.
| Compound Name | [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 7603572 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] 2-chlorobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1Cl)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H13ClN2O3/c1-11(22-17(21)13-9-5-6-10-14(13)18)15-19-20-16(23-15)12-7-3-2-4-8-12/h2-11H,1H3/t11-/m1/s1 |
| InChIKey | YORQUHSNDIPHEM-LLVKDONJSA-N |
| XLogP | 4.31 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |