C21H18N4O6 — CID 55391402
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(cyclopropanecarbonylamino)benzoate (PubChem CID 55391402) has the molecular formula C21H18N4O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(cyclopropanecarbonylamino)benzoate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(cyclopropanecarbonylamino)benzoate |
|---|---|
| PubChem CID | 55391402 |
| Molecular Formula | C21H18N4O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 3-(cyclopropanecarbonylamino)benzoate |
| SMILES | CC(OC(=O)c1cccc(NC(=O)C2CC2)c1)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C21H18N4O6/c1-12(19-23-24-20(31-19)14-7-9-17(10-8-14)25(28)29)30-21(27)15-3-2-4-16(11-15)22-18(26)13-5-6-13/h2-4,7-13H,5-6H2,1H3,(H,22,26) |
| InChIKey | CKMXKVXTYRMRFP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|