C20H19N3O5 — CID 7699963
[(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] (2R)-2-phenylbutanoate (PubChem CID 7699963) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] (2R)-2-phenylbutanoate.
| Compound Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] (2R)-2-phenylbutanoate |
|---|---|
| PubChem CID | 7699963 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [(1R)-1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl] (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)O[C@H](C)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O5/c1-3-17(14-7-5-4-6-8-14)20(24)27-13(2)18-21-22-19(28-18)15-9-11-16(12-10-15)23(25)26/h4-13,17H,3H2,1-2H3/t13-,17-/m1/s1 |
| InChIKey | QPPXCUCWKKGXRQ-CXAGYDPISA-N |
| XLogP | 4.44 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|