C19H14N4O5 — CID 46826920
1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 1H-indole-3-carboxylate (PubChem CID 46826920) has the molecular formula C19H14N4O5 and a molecular weight of 378.34 g/mol. Its IUPAC name is 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 1H-indole-3-carboxylate.
| Compound Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 46826920 |
| Molecular Formula | C19H14N4O5 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]ethyl 1H-indole-3-carboxylate |
| SMILES | CC(OC(=O)c1c[nH]c2ccccc12)c1nnc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C19H14N4O5/c1-11(27-19(24)15-10-20-16-5-3-2-4-14(15)16)17-21-22-18(28-17)12-6-8-13(9-7-12)23(25)26/h2-11,20H,1H3 |
| InChIKey | DQOUOKWICVMYML-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|