C29H25N3O5 — CID 25334206
[(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(benzylamino)-5-nitrobenzoate (PubChem CID 25334206) has the molecular formula C29H25N3O5 and a molecular weight of 495.54 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(benzylamino)-5-nitrobenzoate.
| Compound Name | [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(benzylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 25334206 |
| Molecular Formula | C29H25N3O5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] 2-(benzylamino)-5-nitrobenzoate |
| SMILES | C[C@H](OC(=O)c1cc([N+](=O)[O-])ccc1NCc1ccccc1)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C29H25N3O5/c1-20(28(33)31-27-15-9-8-14-24(27)22-12-6-3-7-13-22)37-29(34)25-18-23(32(35)36)16-17-26(25)30-19-21-10-4-2-5-11-21/h2-18,20,30H,19H2,1H3,(H,31,33)/t20-/m0/s1 |
| InChIKey | GPSXUODMJRQHKW-FQEVSTJZSA-N |
| XLogP | 6.06 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|