C24H23N3O6 — CID 29192580
[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(benzylamino)-5-nitrobenzoate (PubChem CID 29192580) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(benzylamino)-5-nitrobenzoate.
| Compound Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(benzylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 29192580 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(benzylamino)-5-nitrobenzoate |
| SMILES | COc1ccccc1NC(=O)[C@H](C)OC(=O)c1cc([N+](=O)[O-])ccc1NCc1ccccc1 |
| InChI | InChI=1S/C24H23N3O6/c1-16(23(28)26-21-10-6-7-11-22(21)32-2)33-24(29)19-14-18(27(30)31)12-13-20(19)25-15-17-8-4-3-5-9-17/h3-14,16,25H,15H2,1-2H3,(H,26,28)/t16-/m0/s1 |
| InChIKey | RYZGUOZGWNHHHG-INIZCTEOSA-N |
| XLogP | 4.40 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|