C20H20N4O6 — CID 9381271
[(1R)-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl] 2-(2-methoxyethylamino)-5-nitrobenzoate (PubChem CID 9381271) has the molecular formula C20H20N4O6 and a molecular weight of 412.40 g/mol. Its IUPAC name is [(1R)-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl] 2-(2-methoxyethylamino)-5-nitrobenzoate.
| Compound Name | [(1R)-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl] 2-(2-methoxyethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 9381271 |
| Molecular Formula | C20H20N4O6 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | [(1R)-1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethyl] 2-(2-methoxyethylamino)-5-nitrobenzoate |
| SMILES | COCCNc1ccc([N+](=O)[O-])cc1C(=O)O[C@H](C)c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C20H20N4O6/c1-13(19-22-18(23-30-19)14-6-4-3-5-7-14)29-20(25)16-12-15(24(26)27)8-9-17(16)21-10-11-28-2/h3-9,12-13,21H,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | CABFXIAWMPJFLK-CYBMUJFWSA-N |
| XLogP | 3.62 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|