C18H11ClF3N3O5 — CID 55483329
1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl 2-chloro-5-nitrobenzoate (PubChem CID 55483329) has the molecular formula C18H11ClF3N3O5 and a molecular weight of 441.75 g/mol. Its IUPAC name is 1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl 2-chloro-5-nitrobenzoate.
| Compound Name | 1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 55483329 |
| Molecular Formula | C18H11ClF3N3O5 |
| Molecular Weight | 441.75 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]ethyl 2-chloro-5-nitrobenzoate |
| SMILES | CC(OC(=O)c1cc([N+](=O)[O-])ccc1Cl)c1nc(-c2cccc(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C18H11ClF3N3O5/c1-9(29-17(26)13-8-12(25(27)28)5-6-14(13)19)16-23-15(24-30-16)10-3-2-4-11(7-10)18(20,21)22/h2-9H,1H3 |
| InChIKey | GPBWHFLSZJSBRZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.75 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|