C16H11ClN4O5 — CID 46526124
1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 5-chloro-2-nitrobenzoate (PubChem CID 46526124) has the molecular formula C16H11ClN4O5 and a molecular weight of 374.74 g/mol. Its IUPAC name is 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 5-chloro-2-nitrobenzoate.
| Compound Name | 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 46526124 |
| Molecular Formula | C16H11ClN4O5 |
| Molecular Weight | 374.74 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 1-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethyl 5-chloro-2-nitrobenzoate |
| SMILES | CC(OC(=O)c1cc(Cl)ccc1[N+](=O)[O-])c1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C16H11ClN4O5/c1-9(15-19-14(20-26-15)10-3-2-6-18-8-10)25-16(22)12-7-11(17)4-5-13(12)21(23)24/h2-9H,1H3 |
| InChIKey | UMEGBHFIVRRNEQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 121.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|