C15H9ClN4O5 — CID 36911130
(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-2-nitrobenzoate (PubChem CID 36911130) has the molecular formula C15H9ClN4O5 and a molecular weight of 360.71 g/mol. Its IUPAC name is (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-2-nitrobenzoate.
| Compound Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 36911130 |
| Molecular Formula | C15H9ClN4O5 |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-2-nitrobenzoate |
| SMILES | O=C(OCc1nc(-c2cccnc2)no1)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H9ClN4O5/c16-10-3-4-11(12(6-10)20(22)23)15(21)24-8-13-18-14(19-25-13)9-2-1-5-17-7-9/h1-7H,8H2 |
| InChIKey | OOGGGUIGCMGMQU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 121.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|