C20H19N5O5 — CID 29491110
(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 5-nitro-2-piperidin-1-ylbenzoate (PubChem CID 29491110) has the molecular formula C20H19N5O5 and a molecular weight of 409.40 g/mol. Its IUPAC name is (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 5-nitro-2-piperidin-1-ylbenzoate.
| Compound Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 5-nitro-2-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 29491110 |
| Molecular Formula | C20H19N5O5 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 5-nitro-2-piperidin-1-ylbenzoate |
| SMILES | O=C(OCc1nc(-c2cccnc2)no1)c1cc([N+](=O)[O-])ccc1N1CCCCC1 |
| InChI | InChI=1S/C20H19N5O5/c26-20(29-13-18-22-19(23-30-18)14-5-4-8-21-12-14)16-11-15(25(27)28)6-7-17(16)24-9-2-1-3-10-24/h4-8,11-12H,1-3,9-10,13H2 |
| InChIKey | QTBDWMVSPZEUPA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 124.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|