C19H24N4O5 — CID 43046218
(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-(4-methylpiperidin-1-yl)-5-nitrobenzoate (PubChem CID 43046218) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-(4-methylpiperidin-1-yl)-5-nitrobenzoate.
| Compound Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-(4-methylpiperidin-1-yl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 43046218 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-(4-methylpiperidin-1-yl)-5-nitrobenzoate |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)OCc2nc(C(C)C)no2)CC1 |
| InChI | InChI=1S/C19H24N4O5/c1-12(2)18-20-17(28-21-18)11-27-19(24)15-10-14(23(25)26)4-5-16(15)22-8-6-13(3)7-9-22/h4-5,10,12-13H,6-9,11H2,1-3H3 |
| InChIKey | QRCLVBSSWVFCSL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 111.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|