C20H17BrN4O6 — CID 27970235
[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 27970235) has the molecular formula C20H17BrN4O6 and a molecular weight of 489.28 g/mol. Its IUPAC name is [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 27970235 |
| Molecular Formula | C20H17BrN4O6 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(OCc1nc(-c2cccc(Br)c2)no1)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H17BrN4O6/c21-14-3-1-2-13(10-14)19-22-18(31-23-19)12-30-20(26)16-11-15(25(27)28)4-5-17(16)24-6-8-29-9-7-24/h1-5,10-11H,6-9,12H2 |
| InChIKey | OCPAQHHNBIKTLM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 120.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|