C17H20N4O5 — CID 46528687
(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 5-nitro-2-pyrrolidin-1-ylbenzoate (PubChem CID 46528687) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 5-nitro-2-pyrrolidin-1-ylbenzoate.
| Compound Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 5-nitro-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 46528687 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl 5-nitro-2-pyrrolidin-1-ylbenzoate |
| SMILES | CC(C)c1noc(COC(=O)c2cc([N+](=O)[O-])ccc2N2CCCC2)n1 |
| InChI | InChI=1S/C17H20N4O5/c1-11(2)16-18-15(26-19-16)10-25-17(22)13-9-12(21(23)24)5-6-14(13)20-7-3-4-8-20/h5-6,9,11H,3-4,7-8,10H2,1-2H3 |
| InChIKey | NOQPSZXXROQDGL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 111.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|