C27H34N4O4 — CID 55574519
[4-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone (PubChem CID 55574519) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is [4-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone.
| Compound Name | [4-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 55574519 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | [4-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)N2CCN(C(=O)c3ccc(C(C)C)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H34N4O4/c1-19(2)21-4-6-22(7-5-21)26(32)29-14-16-30(17-15-29)27(33)24-18-23(31(34)35)8-9-25(24)28-12-10-20(3)11-13-28/h4-9,18-20H,10-17H2,1-3H3 |
| InChIKey | DQCWFYLHAOJOTH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|