C18H25N3O4 — CID 110878627
(3-hydroxypiperidin-1-yl)-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methanone (PubChem CID 110878627) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is (3-hydroxypiperidin-1-yl)-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methanone.
| Compound Name | (3-hydroxypiperidin-1-yl)-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methanone |
|---|---|
| PubChem CID | 110878627 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (3-hydroxypiperidin-1-yl)-[2-(4-methylpiperidin-1-yl)-5-nitrophenyl]methanone |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)N2CCCC(O)C2)CC1 |
| InChI | InChI=1S/C18H25N3O4/c1-13-6-9-19(10-7-13)17-5-4-14(21(24)25)11-16(17)18(23)20-8-2-3-15(22)12-20/h4-5,11,13,15,22H,2-3,6-10,12H2,1H3 |
| InChIKey | AUDZMYXEILWWFW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|