C25H30N4O4 — CID 42924924
1-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 42924924) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42924924 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-[2-(4-methylpiperidin-1-yl)-5-nitrobenzoyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | CC1CCN(c2ccc([N+](=O)[O-])cc2C(=O)N2CCCC(C(=O)Nc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C25H30N4O4/c1-18-11-14-27(15-12-18)23-10-9-21(29(32)33)16-22(23)25(31)28-13-5-6-19(17-28)24(30)26-20-7-3-2-4-8-20/h2-4,7-10,16,18-19H,5-6,11-15,17H2,1H3,(H,26,30) |
| InChIKey | WOVAQLYTGXGPRT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|