C20H21N4O5- — CID 9090976
4-nitro-2-[[[(3R)-1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]methyl]phenolate (PubChem CID 9090976) has the molecular formula C20H21N4O5- and a molecular weight of 397.41 g/mol. Its IUPAC name is 4-nitro-2-[[[(3R)-1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]methyl]phenolate.
| Compound Name | 4-nitro-2-[[[(3R)-1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]methyl]phenolate |
|---|---|
| PubChem CID | 9090976 |
| Molecular Formula | C20H21N4O5- |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-nitro-2-[[[(3R)-1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]methyl]phenolate |
| SMILES | O=C(NCc1cc([N+](=O)[O-])ccc1[O-])[C@@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H22N4O5/c25-18-9-8-17(24(28)29)11-15(18)12-21-19(26)14-5-4-10-23(13-14)20(27)22-16-6-2-1-3-7-16/h1-3,6-9,11,14,25H,4-5,10,12-13H2,(H,21,26)(H,22,27)/p-1/t14-/m1/s1 |
| InChIKey | BWWGEDHYTCUQEK-CQSZACIVSA-M |
| XLogP | 2.23 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|