C21H24N4O3 — CID 55991364
3-N-(2-anilino-2-oxoethyl)-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 55991364) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-N-(2-anilino-2-oxoethyl)-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(2-anilino-2-oxoethyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 55991364 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3-N-(2-anilino-2-oxoethyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(CNC(=O)C1CCCN(C(=O)Nc2ccccc2)C1)Nc1ccccc1 |
| InChI | InChI=1S/C21H24N4O3/c26-19(23-17-9-3-1-4-10-17)14-22-20(27)16-8-7-13-25(15-16)21(28)24-18-11-5-2-6-12-18/h1-6,9-12,16H,7-8,13-15H2,(H,22,27)(H,23,26)(H,24,28) |
| InChIKey | XLSOYMPGMVHAFQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |