C22H27N5O3 — CID 50846126
3-N-ethyl-1-N-[4-(phenylcarbamoylamino)phenyl]piperidine-1,3-dicarboxamide (PubChem CID 50846126) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-N-ethyl-1-N-[4-(phenylcarbamoylamino)phenyl]piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-ethyl-1-N-[4-(phenylcarbamoylamino)phenyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 50846126 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 3-N-ethyl-1-N-[4-(phenylcarbamoylamino)phenyl]piperidine-1,3-dicarboxamide |
| SMILES | CCNC(=O)C1CCCN(C(=O)Nc2ccc(NC(=O)Nc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C22H27N5O3/c1-2-23-20(28)16-7-6-14-27(15-16)22(30)26-19-12-10-18(11-13-19)25-21(29)24-17-8-4-3-5-9-17/h3-5,8-13,16H,2,6-7,14-15H2,1H3,(H,23,28)(H,26,30)(H2,24,25,29) |
| InChIKey | DWDNJSBWWDGDHO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |