C17H23N3O4 — CID 119223360
2-[[1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]butanoic acid (PubChem CID 119223360) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[[1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]butanoic acid.
| Compound Name | 2-[[1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119223360 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[[1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)C1CCCN(C(=O)Nc2ccccc2)C1)C(=O)O |
| InChI | InChI=1S/C17H23N3O4/c1-2-14(16(22)23)19-15(21)12-7-6-10-20(11-12)17(24)18-13-8-4-3-5-9-13/h3-5,8-9,12,14H,2,6-7,10-11H2,1H3,(H,18,24)(H,19,21)(H,22,23) |
| InChIKey | RVXPHRPHUDTGOW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |