C23H27N3O4 — CID 39995976
methyl (2R)-3-phenyl-2-[[(3R)-1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]propanoate (PubChem CID 39995976) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is methyl (2R)-3-phenyl-2-[[(3R)-1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]propanoate.
| Compound Name | methyl (2R)-3-phenyl-2-[[(3R)-1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 39995976 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | methyl (2R)-3-phenyl-2-[[(3R)-1-(phenylcarbamoyl)piperidine-3-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C23H27N3O4/c1-30-22(28)20(15-17-9-4-2-5-10-17)25-21(27)18-11-8-14-26(16-18)23(29)24-19-12-6-3-7-13-19/h2-7,9-10,12-13,18,20H,8,11,14-16H2,1H3,(H,24,29)(H,25,27)/t18-,20-/m1/s1 |
| InChIKey | CZJBPKAVPTXUNK-UYAOXDASSA-N |
| XLogP | 2.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |