C16H21N3O4 — CID 125149297
(2R)-2-[[(3S)-1-carbamoylpiperidine-3-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 125149297) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is (2R)-2-[[(3S)-1-carbamoylpiperidine-3-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(3S)-1-carbamoylpiperidine-3-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 125149297 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (2R)-2-[[(3S)-1-carbamoylpiperidine-3-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | NC(=O)N1CCC[C@H](C(=O)N[C@H](Cc2ccccc2)C(=O)O)C1 |
| InChI | InChI=1S/C16H21N3O4/c17-16(23)19-8-4-7-12(10-19)14(20)18-13(15(21)22)9-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2,(H2,17,23)(H,18,20)(H,21,22)/t12-,13+/m0/s1 |
| InChIKey | UJKTZYLYXSWWGA-QWHCGFSZSA-N |
| XLogP | 0.59 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |