C11H19N3O5 — CID 114005009
(2R)-2-[(1-carbamoylpiperidine-3-carbonyl)amino]-4-hydroxybutanoic acid (PubChem CID 114005009) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is (2R)-2-[(1-carbamoylpiperidine-3-carbonyl)amino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[(1-carbamoylpiperidine-3-carbonyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 114005009 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (2R)-2-[(1-carbamoylpiperidine-3-carbonyl)amino]-4-hydroxybutanoic acid |
| SMILES | NC(=O)N1CCCC(C(=O)N[C@H](CCO)C(=O)O)C1 |
| InChI | InChI=1S/C11H19N3O5/c12-11(19)14-4-1-2-7(6-14)9(16)13-8(3-5-15)10(17)18/h7-8,15H,1-6H2,(H2,12,19)(H,13,16)(H,17,18)/t7?,8-/m1/s1 |
| InChIKey | WBUHNWNCMURDDE-BRFYHDHCSA-N |
| XLogP | -1.27 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |