C11H18N2O5 — CID 80748785
(2R)-2-[(1-acetylpiperidine-3-carbonyl)amino]-3-hydroxypropanoic acid (PubChem CID 80748785) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is (2R)-2-[(1-acetylpiperidine-3-carbonyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(1-acetylpiperidine-3-carbonyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80748785 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (2R)-2-[(1-acetylpiperidine-3-carbonyl)amino]-3-hydroxypropanoic acid |
| SMILES | CC(=O)N1CCCC(C(=O)N[C@H](CO)C(=O)O)C1 |
| InChI | InChI=1S/C11H18N2O5/c1-7(15)13-4-2-3-8(5-13)10(16)12-9(6-14)11(17)18/h8-9,14H,2-6H2,1H3,(H,12,16)(H,17,18)/t8?,9-/m1/s1 |
| InChIKey | SBVURYFOKFYHGW-YGPZHTELSA-N |
| XLogP | -1.19 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |