C17H29N3O4 — CID 119364788
(2R)-4-methyl-2-[[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]amino]pentanoic acid (PubChem CID 119364788) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2R)-4-methyl-2-[[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]amino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119364788 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (2R)-4-methyl-2-[[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)C1CCCN(C(=O)N2CCCC2)C1)C(=O)O |
| InChI | InChI=1S/C17H29N3O4/c1-12(2)10-14(16(22)23)18-15(21)13-6-5-9-20(11-13)17(24)19-7-3-4-8-19/h12-14H,3-11H2,1-2H3,(H,18,21)(H,22,23)/t13?,14-/m1/s1 |
| InChIKey | UUELNBQDTBTDKA-ARLHGKGLSA-N |
| XLogP | 1.53 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |