C13H22FNO3 — CID 122126117
(2S)-2-[(3-fluorocyclohexanecarbonyl)amino]-4-methylpentanoic acid (PubChem CID 122126117) has the molecular formula C13H22FNO3 and a molecular weight of 259.32 g/mol. Its IUPAC name is (2S)-2-[(3-fluorocyclohexanecarbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(3-fluorocyclohexanecarbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122126117 |
| Molecular Formula | C13H22FNO3 |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2S)-2-[(3-fluorocyclohexanecarbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)C1CCCC(F)C1)C(=O)O |
| InChI | InChI=1S/C13H22FNO3/c1-8(2)6-11(13(17)18)15-12(16)9-4-3-5-10(14)7-9/h8-11H,3-7H2,1-2H3,(H,15,16)(H,17,18)/t9?,10?,11-/m0/s1 |
| InChIKey | CYGDMXQNLJTABJ-ILDUYXDCSA-N |
| XLogP | 2.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |