C13H24N2O3S — CID 103801448
1-acetyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)piperidine-3-carboxamide (PubChem CID 103801448) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is 1-acetyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-acetyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 103801448 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-acetyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)piperidine-3-carboxamide |
| SMILES | CSC(CO)C(C)NC(=O)C1CCCN(C(C)=O)C1 |
| InChI | InChI=1S/C13H24N2O3S/c1-9(12(8-16)19-3)14-13(18)11-5-4-6-15(7-11)10(2)17/h9,11-12,16H,4-8H2,1-3H3,(H,14,18) |
| InChIKey | JUZLLUAXLOKEKE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |