C16H28N2O4 — CID 120614310
(2S)-2-[(1-butanoylpiperidine-3-carbonyl)amino]hexanoic acid (PubChem CID 120614310) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2S)-2-[(1-butanoylpiperidine-3-carbonyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(1-butanoylpiperidine-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 120614310 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2S)-2-[(1-butanoylpiperidine-3-carbonyl)amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C1CCCN(C(=O)CCC)C1)C(=O)O |
| InChI | InChI=1S/C16H28N2O4/c1-3-5-9-13(16(21)22)17-15(20)12-8-6-10-18(11-12)14(19)7-4-2/h12-13H,3-11H2,1-2H3,(H,17,20)(H,21,22)/t12?,13-/m0/s1 |
| InChIKey | YFUAHGXPFGGNGS-ABLWVSNPSA-N |
| XLogP | 1.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |