C27H29N3O2 — CID 41073570
(3S)-1-N-phenyl-3-N-[(1S)-1-(4-phenylphenyl)ethyl]piperidine-1,3-dicarboxamide (PubChem CID 41073570) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is (3S)-1-N-phenyl-3-N-[(1S)-1-(4-phenylphenyl)ethyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-phenyl-3-N-[(1S)-1-(4-phenylphenyl)ethyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 41073570 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (3S)-1-N-phenyl-3-N-[(1S)-1-(4-phenylphenyl)ethyl]piperidine-1,3-dicarboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1CCCN(C(=O)Nc2ccccc2)C1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O2/c1-20(21-14-16-23(17-15-21)22-9-4-2-5-10-22)28-26(31)24-11-8-18-30(19-24)27(32)29-25-12-6-3-7-13-25/h2-7,9-10,12-17,20,24H,8,11,18-19H2,1H3,(H,28,31)(H,29,32)/t20-,24-/m0/s1 |
| InChIKey | UEUYOFXRFJVEFQ-RDPSFJRHSA-N |
| XLogP | 5.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |