C20H23N3O3 — CID 32578740
(3S)-1-N-phenyl-3-N-phenylmethoxypiperidine-1,3-dicarboxamide (PubChem CID 32578740) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (3S)-1-N-phenyl-3-N-phenylmethoxypiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-phenyl-3-N-phenylmethoxypiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 32578740 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (3S)-1-N-phenyl-3-N-phenylmethoxypiperidine-1,3-dicarboxamide |
| SMILES | O=C(NOCc1ccccc1)[C@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H23N3O3/c24-19(22-26-15-16-8-3-1-4-9-16)17-10-7-13-23(14-17)20(25)21-18-11-5-2-6-12-18/h1-6,8-9,11-12,17H,7,10,13-15H2,(H,21,25)(H,22,24)/t17-/m0/s1 |
| InChIKey | PQBNYHXIFNSINH-KRWDZBQOSA-N |
| XLogP | 3.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|